| Name | sodium ethanesulphonate |
| Synonyms | Sodium ethylsulfonate SODIUM ETHANESULFONATE sodium ethanesulfonate Sodium ethanesulphonate sodium ethanesulphonate Ethylsulfonic acid sodium salt ETHYLSULFONIC ACID SODIUM SALT ETHANESULFONIC ACID SODIUM SALT 2-{[2-(phenylcarbamoyl)phenyl]carbamoyl}benzoic acid Ethylsulfonic Acid Sodium SaltEthanesulfonic Acid Sodium Salt |
| CAS | 5324-47-0 |
| EINECS | 226-194-9 |
| InChI | InChI=1/C21H16N2O4/c24-19(15-10-4-5-11-16(15)21(26)27)23-18-13-7-6-12-17(18)20(25)22-14-8-2-1-3-9-14/h1-13H,(H,22,25)(H,23,24)(H,26,27) |
| Molecular Formula | C2H5NaO3S |
| Molar Mass | 132.11 |
| Density | 1.387g/cm3 |
| Melting Point | 267-270°C (dec.) |
| Boling Point | 459°C at 760 mmHg |
| Flash Point | 231.4°C |
| Vapor Presure | 3.22E-09mmHg at 25°C |
| Appearance | Powder |
| Color | White |
| Storage Condition | Room Temprature |
| Sensitive | Hygroscopic |
| Refractive Index | 1.717 |
| MDL | MFCD00066498 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | 26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |